AKOS BAR-1352
3-(2-Thienyl)pyridine
CAS: 21298-53-3
Molecular Formula: C9H7NS
AKOS BAR-1352 - Names and Identifiers
| Name | 3-(2-Thienyl)pyridine |
| Synonyms | AKOS BAR-1352 BUTTPARK 121 4-38 3-(2-THIENYL)PYRIDINE 3-(2-Thienyl)pyridine 2-(3-Pyridyl)thiophene 3-(THIEN-2-YL)PYRIDINE Pyridine, 3-(2-thienyl)- 3-(thiophen-2-yl)pyridine 3-Thiophene-2-yl-pyridine |
| CAS | 21298-53-3 |
| EINECS | 681-053-2 |
| InChI | InChI=1/C9H7NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7H |
AKOS BAR-1352 - Physico-chemical Properties
| Molecular Formula | C9H7NS |
| Molar Mass | 161.22 |
| Density | 1.173±0.06 g/cm3(Predicted) |
| Boling Point | 95-100°C 1mm |
| Flash Point | 95-100°C/1mm |
| Vapor Presure | 0.00716mmHg at 25°C |
| Maximum wavelength(λmax) | 284nm(Hexane)(lit.) |
| BRN | 971159 |
| pKa | 4.73±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.6480 |
| MDL | MFCD01860052 |
AKOS BAR-1352 - Risk and Safety
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
AKOS BAR-1352 - Introduction
3-(2-Thienyl)pyridine is an organic compound with the chemical formula C9H7NS. Its properties are as follows:
1. Appearance: 3-(2-Thienyl)pyridine is a white to light yellow crystalline or powdery solid.
2. Solubility: it can be dissolved in ethanol, ethers, benzene and dichloromethane, but the solubility in water is low.
3. Melting Point: The melting point of 3-(2-Thienyl)pyridine is about 78-82°C.
4. Stability: It is relatively stable to light, heat and air.
3-(2-Thienyl)pyridine has the following main uses in practical applications:
1. Organic optoelectronic devices: 3-(2-Thienyl)pyridine is widely used in organic solar cells and organic electroluminescent diodes (OLED) due to its excellent photoelectric and conductive properties. And organic thin film transistors and other optoelectronic devices.
2. Organic synthesis intermediate: It can be used as a catalyst and ligand in organic synthesis reaction, and participate in the synthesis reaction of pyridine compounds.
3. Biological activity Research: 3-(2-Thienyl)pyridine and its derivatives have certain activities in the field of biomedicine, such as antibacterial activity, anti-tumor activity and anti-inflammatory activity, therefore, it is also used in biological activity research and drug development.
The method for producing 3-(2-Thienyl)pyridine is generally carried out by chemical synthesis. A common method is the reaction of pyridine and 2-thiophenecarboxaldehyde under alkaline conditions to produce 3-(2-Thienyl)pyridine.
Regarding safety information, 3-(2-Thienyl)pyridine is a chemical, and the following aspects need to be noted:
1. Toxicity: 3-(2-Thienyl)pyridine may have certain toxicity to human body at a certain concentration, so pay attention to avoid inhalation, contact with skin and eating during use.
2. Handling: in contact with 3-(2-Thienyl)pyridine, should wear appropriate protective equipment, such as gloves, goggles and protective clothing.
3. Waste treatment: When handling 3-(2-Thienyl)pyridine waste, you should follow local regulations and follow the correct treatment methods.
in the use of any chemicals, should be strictly in accordance with the safety procedures, and consult the guidance of professionals.
1. Appearance: 3-(2-Thienyl)pyridine is a white to light yellow crystalline or powdery solid.
2. Solubility: it can be dissolved in ethanol, ethers, benzene and dichloromethane, but the solubility in water is low.
3. Melting Point: The melting point of 3-(2-Thienyl)pyridine is about 78-82°C.
4. Stability: It is relatively stable to light, heat and air.
3-(2-Thienyl)pyridine has the following main uses in practical applications:
1. Organic optoelectronic devices: 3-(2-Thienyl)pyridine is widely used in organic solar cells and organic electroluminescent diodes (OLED) due to its excellent photoelectric and conductive properties. And organic thin film transistors and other optoelectronic devices.
2. Organic synthesis intermediate: It can be used as a catalyst and ligand in organic synthesis reaction, and participate in the synthesis reaction of pyridine compounds.
3. Biological activity Research: 3-(2-Thienyl)pyridine and its derivatives have certain activities in the field of biomedicine, such as antibacterial activity, anti-tumor activity and anti-inflammatory activity, therefore, it is also used in biological activity research and drug development.
The method for producing 3-(2-Thienyl)pyridine is generally carried out by chemical synthesis. A common method is the reaction of pyridine and 2-thiophenecarboxaldehyde under alkaline conditions to produce 3-(2-Thienyl)pyridine.
Regarding safety information, 3-(2-Thienyl)pyridine is a chemical, and the following aspects need to be noted:
1. Toxicity: 3-(2-Thienyl)pyridine may have certain toxicity to human body at a certain concentration, so pay attention to avoid inhalation, contact with skin and eating during use.
2. Handling: in contact with 3-(2-Thienyl)pyridine, should wear appropriate protective equipment, such as gloves, goggles and protective clothing.
3. Waste treatment: When handling 3-(2-Thienyl)pyridine waste, you should follow local regulations and follow the correct treatment methods.
in the use of any chemicals, should be strictly in accordance with the safety procedures, and consult the guidance of professionals.
Last Update：2024-04-09 21:21:28
Supplier List
Product Name: 3-(2-Thienyl)Pyridine Visit Supplier Webpage Request for quotation
CAS: 21298-53-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 21298-53-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-(2-Thienyl)Pyridine Visit Supplier Webpage Request for quotation
CAS: 21298-53-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 21298-53-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History